C29H37IO4 — CID 124894731
[(3R,5S,8S,10S,13S,14R,16R,17R)-17-acetyl-17-hydroxy-10,13,16-trimethyl-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-iodobenzoate (PubChem CID 124894731) has the molecular formula C29H37IO4 and a molecular weight of 576.52 g/mol. Its IUPAC name is [(3R,5S,8S,10S,13S,14R,16R,17R)-17-acetyl-17-hydroxy-10,13,16-trimethyl-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-iodobenzoate.
| Compound Name | [(3R,5S,8S,10S,13S,14R,16R,17R)-17-acetyl-17-hydroxy-10,13,16-trimethyl-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-iodobenzoate |
|---|---|
| PubChem CID | 124894731 |
| Molecular Formula | C29H37IO4 |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | [(3R,5S,8S,10S,13S,14R,16R,17R)-17-acetyl-17-hydroxy-10,13,16-trimethyl-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-iodobenzoate |
| SMILES | CC(=O)[C@@]1(O)[C@H](C)C[C@@H]2[C@@H]3CC[C@H]4C[C@H](OC(=O)c5cccc(I)c5)CC[C@]4(C)C3=CC[C@@]21C |
| InChI | InChI=1S/C29H37IO4/c1-17-14-25-23-9-8-20-16-22(34-26(32)19-6-5-7-21(30)15-19)10-12-27(20,3)24(23)11-13-28(25,4)29(17,33)18(2)31/h5-7,11,15,17,20,22-23,25,33H,8-10,12-14,16H2,1-4H3/t17-,20+,22-,23-,25-,27+,28+,29+/m1/s1 |
| InChIKey | RHCMOQFYLNZMFY-WXLXQRNISA-N |
| XLogP | 6.35 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|