C24H42O2P2 — CID 147565402
[(3R,5R,6S,10R,13R)-10,13-dimethyl-17-pentan-2-yl-3-phosphoroso-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxyphosphane (PubChem CID 147565402) has the molecular formula C24H42O2P2 and a molecular weight of 424.55 g/mol. Its IUPAC name is [(3R,5R,6S,10R,13R)-10,13-dimethyl-17-pentan-2-yl-3-phosphoroso-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxyphosphane.
| Compound Name | [(3R,5R,6S,10R,13R)-10,13-dimethyl-17-pentan-2-yl-3-phosphoroso-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxyphosphane |
|---|---|
| PubChem CID | 147565402 |
| Molecular Formula | C24H42O2P2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | [(3R,5R,6S,10R,13R)-10,13-dimethyl-17-pentan-2-yl-3-phosphoroso-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxyphosphane |
| SMILES | CCCC(C)C1CCC2C3C[C@H](OP)[C@@H]4C[C@H](P=O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C24H42O2P2/c1-5-6-15(2)18-7-8-19-17-14-22(26-27)21-13-16(28-25)9-11-24(21,4)20(17)10-12-23(18,19)3/h15-22H,5-14,27H2,1-4H3/t15?,16-,17?,18?,19?,20?,21+,22+,23-,24-/m1/s1 |
| InChIKey | NUBKLBRJVDQYEK-BTSUCGAKSA-N |
| XLogP | 7.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|