C26H40O5 — CID 102505985
[(3R,5R,6S,8S,9S,10R,13R,14S,17R)-6-formyloxy-10,13-dimethyl-17-[(2R)-5-oxopentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate (PubChem CID 102505985) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is [(3R,5R,6S,8S,9S,10R,13R,14S,17R)-6-formyloxy-10,13-dimethyl-17-[(2R)-5-oxopentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate.
| Compound Name | [(3R,5R,6S,8S,9S,10R,13R,14S,17R)-6-formyloxy-10,13-dimethyl-17-[(2R)-5-oxopentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate |
|---|---|
| PubChem CID | 102505985 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | [(3R,5R,6S,8S,9S,10R,13R,14S,17R)-6-formyloxy-10,13-dimethyl-17-[(2R)-5-oxopentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate |
| SMILES | C[C@H](CCC=O)[C@H]1CC[C@H]2[C@@H]3C[C@H](OC=O)[C@@H]4C[C@H](OC=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H40O5/c1-17(5-4-12-27)20-6-7-21-19-14-24(31-16-29)23-13-18(30-15-28)8-10-26(23,3)22(19)9-11-25(20,21)2/h12,15-24H,4-11,13-14H2,1-3H3/t17-,18-,19+,20-,21+,22+,23+,24+,25-,26-/m1/s1 |
| InChIKey | CZJBREWHILHGGF-CVARHHIYSA-N |
| XLogP | 4.95 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|