C25H37NO4 — CID 70676169
[(3R,5R,6S,8S,9S,10R,13R,14S,17R)-17-[(2R)-1-cyanopropan-2-yl]-6-formyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate (PubChem CID 70676169) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is [(3R,5R,6S,8S,9S,10R,13R,14S,17R)-17-[(2R)-1-cyanopropan-2-yl]-6-formyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate.
| Compound Name | [(3R,5R,6S,8S,9S,10R,13R,14S,17R)-17-[(2R)-1-cyanopropan-2-yl]-6-formyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate |
|---|---|
| PubChem CID | 70676169 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | [(3R,5R,6S,8S,9S,10R,13R,14S,17R)-17-[(2R)-1-cyanopropan-2-yl]-6-formyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate |
| SMILES | C[C@H](CC#N)[C@H]1CC[C@H]2[C@@H]3C[C@H](OC=O)[C@@H]4C[C@H](OC=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H37NO4/c1-16(8-11-26)19-4-5-20-18-13-23(30-15-28)22-12-17(29-14-27)6-9-25(22,3)21(18)7-10-24(19,20)2/h14-23H,4-10,12-13H2,1-3H3/t16-,17-,18+,19-,20+,21+,22+,23+,24-,25-/m1/s1 |
| InChIKey | RYNVQFJICAKHGJ-SDSSBREGSA-N |
| XLogP | 4.89 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|