C27H35N3O3 — CID 163789570
1-[2-[(2S,5R,6R,8R,11S,12S,15S,16S)-5-hydroxy-6-methoxy-2,16-dimethyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-1(18)-enyl]-2-oxoethyl]pyrazole-4-carbonitrile (PubChem CID 163789570) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-[2-[(2S,5R,6R,8R,11S,12S,15S,16S)-5-hydroxy-6-methoxy-2,16-dimethyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-1(18)-enyl]-2-oxoethyl]pyrazole-4-carbonitrile.
| Compound Name | 1-[2-[(2S,5R,6R,8R,11S,12S,15S,16S)-5-hydroxy-6-methoxy-2,16-dimethyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-1(18)-enyl]-2-oxoethyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 163789570 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 1-[2-[(2S,5R,6R,8R,11S,12S,15S,16S)-5-hydroxy-6-methoxy-2,16-dimethyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-1(18)-enyl]-2-oxoethyl]pyrazole-4-carbonitrile |
| SMILES | COC1C2[C@H]3CC[C@@H]4C(=CC[C@]5(C)[C@@H](C(=O)Cn6cc(C#N)cn6)CC[C@@H]45)[C@@]3(C)CC[C@]12O |
| InChI | InChI=1S/C27H35N3O3/c1-25-9-8-19-17(4-5-21-23-24(33-3)27(23,32)11-10-26(19,21)2)18(25)6-7-20(25)22(31)15-30-14-16(12-28)13-29-30/h8,13-14,17-18,20-21,23-24,32H,4-7,9-11,15H2,1-3H3/t17-,18-,20+,21+,23?,24?,25-,26+,27+/m0/s1 |
| InChIKey | MVMOJRKXIPIZEF-QRRDNQLFSA-N |
| XLogP | 3.89 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|