C25H37N3O3 — CID 145065332
2-ethoxy-10,13-dimethyl-17-[2-(triazol-2-yl)acetyl]-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one (PubChem CID 145065332) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is 2-ethoxy-10,13-dimethyl-17-[2-(triazol-2-yl)acetyl]-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one.
| Compound Name | 2-ethoxy-10,13-dimethyl-17-[2-(triazol-2-yl)acetyl]-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 145065332 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | 2-ethoxy-10,13-dimethyl-17-[2-(triazol-2-yl)acetyl]-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one |
| SMILES | CCOC1CCC2CCC3C4CCC(C(=O)Cn5nccn5)C4(C)CC(=O)C3C2(C)C1 |
| InChI | InChI=1S/C25H37N3O3/c1-4-31-17-7-5-16-6-8-18-19-9-10-20(22(30)15-28-26-11-12-27-28)25(19,3)14-21(29)23(18)24(16,2)13-17/h11-12,16-20,23H,4-10,13-15H2,1-3H3 |
| InChIKey | VTBBNNAVQHVDGV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |