C28H39N3O2 — CID 123898263
1-[5-(2-cyclopropylethynyl)-5-hydroxy-15-methyl-14-tetracyclo[8.7.1.02,7.011,15]octadecanyl]-2-(triazol-2-yl)ethanone (PubChem CID 123898263) has the molecular formula C28H39N3O2 and a molecular weight of 449.64 g/mol. Its IUPAC name is 1-[5-(2-cyclopropylethynyl)-5-hydroxy-15-methyl-14-tetracyclo[8.7.1.02,7.011,15]octadecanyl]-2-(triazol-2-yl)ethanone.
| Compound Name | 1-[5-(2-cyclopropylethynyl)-5-hydroxy-15-methyl-14-tetracyclo[8.7.1.02,7.011,15]octadecanyl]-2-(triazol-2-yl)ethanone |
|---|---|
| PubChem CID | 123898263 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | 1-[5-(2-cyclopropylethynyl)-5-hydroxy-15-methyl-14-tetracyclo[8.7.1.02,7.011,15]octadecanyl]-2-(triazol-2-yl)ethanone |
| SMILES | CC12CCC3CC(CCC4CC(O)(C#CC5CC5)CCC34)C1CCC2C(=O)Cn1nccn1 |
| InChI | InChI=1S/C28H39N3O2/c1-27-11-9-20-16-21(24(27)6-7-25(27)26(32)18-31-29-14-15-30-31)4-5-22-17-28(33,13-10-23(20)22)12-8-19-2-3-19/h14-15,19-25,33H,2-7,9-11,13,16-18H2,1H3 |
| InChIKey | NOJCYPRTMZJOMA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|