C24H39BrO2 — CID 167407611
2-bromo-1-[(1S,2S,5S,8R,11S,12S,15S,16S)-2-ethyl-5-hydroxy-5,16-dimethyl-15-tetracyclo[9.7.0.02,8.012,16]octadecanyl]ethanone (PubChem CID 167407611) has the molecular formula C24H39BrO2 and a molecular weight of 439.48 g/mol. Its IUPAC name is 2-bromo-1-[(1S,2S,5S,8R,11S,12S,15S,16S)-2-ethyl-5-hydroxy-5,16-dimethyl-15-tetracyclo[9.7.0.02,8.012,16]octadecanyl]ethanone.
| Compound Name | 2-bromo-1-[(1S,2S,5S,8R,11S,12S,15S,16S)-2-ethyl-5-hydroxy-5,16-dimethyl-15-tetracyclo[9.7.0.02,8.012,16]octadecanyl]ethanone |
|---|---|
| PubChem CID | 167407611 |
| Molecular Formula | C24H39BrO2 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 2-bromo-1-[(1S,2S,5S,8R,11S,12S,15S,16S)-2-ethyl-5-hydroxy-5,16-dimethyl-15-tetracyclo[9.7.0.02,8.012,16]octadecanyl]ethanone |
| SMILES | CC[C@]12CC[C@@](C)(O)CC[C@H]1CC[C@H]1[C@@H]3CC[C@H](C(=O)CBr)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C24H39BrO2/c1-4-24-14-13-22(2,27)11-9-16(24)5-6-17-18-7-8-20(21(26)15-25)23(18,3)12-10-19(17)24/h16-20,27H,4-15H2,1-3H3/t16-,17+,18+,19+,20-,22+,23+,24+/m1/s1 |
| InChIKey | HKTNPTXLNWRYKA-BLWRCAOQSA-N |
| XLogP | 6.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|