C25H41BrO3 — CID 156666976
2-bromo-1-[(3R,5S,8S,9S,10S,13S,14S,17S)-3-(ethoxymethyl)-10-ethyl-3-hydroxy-13-methyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 156666976) has the molecular formula C25H41BrO3 and a molecular weight of 469.50 g/mol. Its IUPAC name is 2-bromo-1-[(3R,5S,8S,9S,10S,13S,14S,17S)-3-(ethoxymethyl)-10-ethyl-3-hydroxy-13-methyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-bromo-1-[(3R,5S,8S,9S,10S,13S,14S,17S)-3-(ethoxymethyl)-10-ethyl-3-hydroxy-13-methyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 156666976 |
| Molecular Formula | C25H41BrO3 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 2-bromo-1-[(3R,5S,8S,9S,10S,13S,14S,17S)-3-(ethoxymethyl)-10-ethyl-3-hydroxy-13-methyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CCOC[C@@]1(O)CC[C@@]2(CC)[C@@H](CC[C@H]3[C@@H]4CC[C@H](C(=O)CBr)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C25H41BrO3/c1-4-25-13-12-24(28,16-29-5-2)14-17(25)6-7-18-19-8-9-21(22(27)15-26)23(19,3)11-10-20(18)25/h17-21,28H,4-16H2,1-3H3/t17-,18-,19-,20-,21+,23-,24+,25-/m0/s1 |
| InChIKey | JHTZWDNTQCDDMG-PTKFBTQISA-N |
| XLogP | 5.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|