C22H33BrO2 — CID 145065085
17-(2-bromoacetyl)-3,10,13-trimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one (PubChem CID 145065085) has the molecular formula C22H33BrO2 and a molecular weight of 409.41 g/mol. Its IUPAC name is 17-(2-bromoacetyl)-3,10,13-trimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one.
| Compound Name | 17-(2-bromoacetyl)-3,10,13-trimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 145065085 |
| Molecular Formula | C22H33BrO2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 17-(2-bromoacetyl)-3,10,13-trimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one |
| SMILES | CC1CCC2(C)C(CCC3C4CCC(C(=O)CBr)C4(C)CC(=O)C32)C1 |
| InChI | InChI=1S/C22H33BrO2/c1-13-8-9-21(2)14(10-13)4-5-15-16-6-7-17(19(25)12-23)22(16,3)11-18(24)20(15)21/h13-17,20H,4-12H2,1-3H3 |
| InChIKey | BSYMHHMEBITFTF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|