C27H40O5 — CID 86734285
4-acetyl-1-[(3R,5S,8S,9S,10S,13S,14S,17S)-3-hydroxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]hexane-1,5-dione (PubChem CID 86734285) has the molecular formula C27H40O5 and a molecular weight of 444.61 g/mol. Its IUPAC name is 4-acetyl-1-[(3R,5S,8S,9S,10S,13S,14S,17S)-3-hydroxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]hexane-1,5-dione.
| Compound Name | 4-acetyl-1-[(3R,5S,8S,9S,10S,13S,14S,17S)-3-hydroxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]hexane-1,5-dione |
|---|---|
| PubChem CID | 86734285 |
| Molecular Formula | C27H40O5 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | 4-acetyl-1-[(3R,5S,8S,9S,10S,13S,14S,17S)-3-hydroxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]hexane-1,5-dione |
| SMILES | CC(=O)C(CCC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@H](O)CC[C@]4(C)[C@H]3C(=O)C[C@]12C)C(C)=O |
| InChI | InChI=1S/C27H40O5/c1-15(28)19(16(2)29)7-10-23(31)22-9-8-21-20-6-5-17-13-18(30)11-12-26(17,3)25(20)24(32)14-27(21,22)4/h17-22,25,30H,5-14H2,1-4H3/t17-,18+,20-,21-,22+,25+,26-,27-/m0/s1 |
| InChIKey | ICROQAPJXPTUBU-NPWXNKLMSA-N |
| XLogP | 4.33 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|