C28H39NO3S — CID 86734299
(3R,5S,8S,9S,10S,13S,14S,17S)-3-hydroxy-10,13-dimethyl-17-[3-(pyridin-3-ylmethylsulfanyl)propanoyl]-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one (PubChem CID 86734299) has the molecular formula C28H39NO3S and a molecular weight of 469.69 g/mol. Its IUPAC name is (3R,5S,8S,9S,10S,13S,14S,17S)-3-hydroxy-10,13-dimethyl-17-[3-(pyridin-3-ylmethylsulfanyl)propanoyl]-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one.
| Compound Name | (3R,5S,8S,9S,10S,13S,14S,17S)-3-hydroxy-10,13-dimethyl-17-[3-(pyridin-3-ylmethylsulfanyl)propanoyl]-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 86734299 |
| Molecular Formula | C28H39NO3S |
| Molecular Weight | 469.69 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | (3R,5S,8S,9S,10S,13S,14S,17S)-3-hydroxy-10,13-dimethyl-17-[3-(pyridin-3-ylmethylsulfanyl)propanoyl]-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one |
| SMILES | C[C@]12CC[C@@H](O)C[C@@H]1CC[C@H]1[C@@H]3CC[C@H](C(=O)CCSCc4cccnc4)[C@@]3(C)CC(=O)[C@@H]12 |
| InChI | InChI=1S/C28H39NO3S/c1-27-11-9-20(30)14-19(27)5-6-21-22-7-8-23(28(22,2)15-25(32)26(21)27)24(31)10-13-33-17-18-4-3-12-29-16-18/h3-4,12,16,19-23,26,30H,5-11,13-15,17H2,1-2H3/t19-,20+,21-,22-,23+,26+,27-,28-/m0/s1 |
| InChIKey | PXMYOUHSWPVAOG-ZKEKCBBCSA-N |
| XLogP | 5.47 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.69 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|