C21H30Br2O3 — CID 86734034
(3R,4R,5R,8S,9S,10R,13S,14S,17S)-4-bromo-17-(2-bromoacetyl)-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one (PubChem CID 86734034) has the molecular formula C21H30Br2O3 and a molecular weight of 490.28 g/mol. Its IUPAC name is (3R,4R,5R,8S,9S,10R,13S,14S,17S)-4-bromo-17-(2-bromoacetyl)-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one.
| Compound Name | (3R,4R,5R,8S,9S,10R,13S,14S,17S)-4-bromo-17-(2-bromoacetyl)-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 86734034 |
| Molecular Formula | C21H30Br2O3 |
| Molecular Weight | 490.28 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | (3R,4R,5R,8S,9S,10R,13S,14S,17S)-4-bromo-17-(2-bromoacetyl)-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one |
| SMILES | C[C@]12CC[C@@H](O)[C@H](Br)[C@@H]1CC[C@H]1[C@@H]3CC[C@H](C(=O)CBr)[C@@]3(C)CC(=O)[C@@H]12 |
| InChI | InChI=1S/C21H30Br2O3/c1-20-8-7-15(24)19(23)14(20)4-3-11-12-5-6-13(17(26)10-22)21(12,2)9-16(25)18(11)20/h11-15,18-19,24H,3-10H2,1-2H3/t11-,12-,13+,14-,15+,18+,19+,20-,21-/m0/s1 |
| InChIKey | HANBFBLTBIXABE-ZQBKQGOLSA-N |
| XLogP | 4.52 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.28 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|