C21H29BrO4 — CID 70355355
(5R,6S,8S,9S,10R,13S,14S,17S)-6-bromo-17-(2-hydroxyacetyl)-10,13-dimethyl-2,4,5,6,7,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-dione (PubChem CID 70355355) has the molecular formula C21H29BrO4 and a molecular weight of 425.36 g/mol. Its IUPAC name is (5R,6S,8S,9S,10R,13S,14S,17S)-6-bromo-17-(2-hydroxyacetyl)-10,13-dimethyl-2,4,5,6,7,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | (5R,6S,8S,9S,10R,13S,14S,17S)-6-bromo-17-(2-hydroxyacetyl)-10,13-dimethyl-2,4,5,6,7,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 70355355 |
| Molecular Formula | C21H29BrO4 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | (5R,6S,8S,9S,10R,13S,14S,17S)-6-bromo-17-(2-hydroxyacetyl)-10,13-dimethyl-2,4,5,6,7,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-dione |
| SMILES | C[C@]12CCC(=O)C[C@H]1[C@@H](Br)C[C@H]1[C@@H]3CC[C@H](C(=O)CO)[C@@]3(C)CC(=O)[C@@H]12 |
| InChI | InChI=1S/C21H29BrO4/c1-20-6-5-11(24)7-15(20)16(22)8-12-13-3-4-14(18(26)10-23)21(13,2)9-17(25)19(12)20/h12-16,19,23H,3-10H2,1-2H3/t12-,13-,14+,15-,16-,19+,20-,21-/m0/s1 |
| InChIKey | LLOKICNWSYCOTK-BOQOJASCSA-N |
| XLogP | 3.33 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|