C21H34O2 — CID 78046402
3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 78046402) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is 3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | 3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 78046402 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | 3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | CC1CCC2(C)C(CCC3C2CCC2(C)C(C(=O)O)CCC32)C1 |
| InChI | InChI=1S/C21H34O2/c1-13-8-10-20(2)14(12-13)4-5-15-16-6-7-18(19(22)23)21(16,3)11-9-17(15)20/h13-18H,4-12H2,1-3H3,(H,22,23) |
| InChIKey | ZTANNJALJYOTKZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |