C29H48O6 — CID 156845778
2-carboxyoxyethyl 2-methylpropanoate;1-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone (PubChem CID 156845778) has the molecular formula C29H48O6 and a molecular weight of 492.70 g/mol. Its IUPAC name is 2-carboxyoxyethyl 2-methylpropanoate;1-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone.
| Compound Name | 2-carboxyoxyethyl 2-methylpropanoate;1-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone |
|---|---|
| PubChem CID | 156845778 |
| Molecular Formula | C29H48O6 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | 2-carboxyoxyethyl 2-methylpropanoate;1-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone |
| SMILES | CC(=O)C1CCC2C3CCC4CC(C)CCC4(C)C3CCC12C.CC(C)C(=O)OCCOC(=O)O |
| InChI | InChI=1S/C22H36O.C7H12O5/c1-14-9-11-21(3)16(13-14)5-6-17-19-8-7-18(15(2)23)22(19,4)12-10-20(17)21;1-5(2)6(8)11-3-4-12-7(9)10/h14,16-20H,5-13H2,1-4H3;5H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | AIPQJDREQMXEAU-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|