C23H37BrO2 — CID 145443321
2-bromo-1-(7-methoxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone (PubChem CID 145443321) has the molecular formula C23H37BrO2 and a molecular weight of 425.45 g/mol. Its IUPAC name is 2-bromo-1-(7-methoxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone.
| Compound Name | 2-bromo-1-(7-methoxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone |
|---|---|
| PubChem CID | 145443321 |
| Molecular Formula | C23H37BrO2 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 2-bromo-1-(7-methoxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone |
| SMILES | COC1CC2CC(C)CCC2(C)C2CCC3(C)C(C(=O)CBr)CCC3C12 |
| InChI | InChI=1S/C23H37BrO2/c1-14-7-9-22(2)15(11-14)12-20(26-4)21-17-6-5-16(19(25)13-24)23(17,3)10-8-18(21)22/h14-18,20-21H,5-13H2,1-4H3 |
| InChIKey | QZWSSDOREPFRRD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|