C29H43NO — CID 145443157
2-(N-methylanilino)-1-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone (PubChem CID 145443157) has the molecular formula C29H43NO and a molecular weight of 421.67 g/mol. Its IUPAC name is 2-(N-methylanilino)-1-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone.
| Compound Name | 2-(N-methylanilino)-1-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone |
|---|---|
| PubChem CID | 145443157 |
| Molecular Formula | C29H43NO |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.33 |
| IUPAC Name | 2-(N-methylanilino)-1-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone |
| SMILES | CC1CCC2(C)C(CCC3C2CCC2(C)C(C(=O)CN(C)c4ccccc4)CCC32)C1 |
| InChI | InChI=1S/C29H43NO/c1-20-14-16-28(2)21(18-20)10-11-23-24-12-13-26(29(24,3)17-15-25(23)28)27(31)19-30(4)22-8-6-5-7-9-22/h5-9,20-21,23-26H,10-19H2,1-4H3 |
| InChIKey | RXGWJCSKADKMMJ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |