C28H41F2N3O — CID 166762980
2-(N,2-diamino-3,4-difluoroanilino)-1-[(13S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 166762980) has the molecular formula C28H41F2N3O and a molecular weight of 473.65 g/mol. Its IUPAC name is 2-(N,2-diamino-3,4-difluoroanilino)-1-[(13S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-(N,2-diamino-3,4-difluoroanilino)-1-[(13S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 166762980 |
| Molecular Formula | C28H41F2N3O |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.32 |
| IUPAC Name | 2-(N,2-diamino-3,4-difluoroanilino)-1-[(13S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC1CCC2(C)C(CCC3C2CC[C@]2(C)C(C(=O)CN(N)c4ccc(F)c(F)c4N)CCC32)C1 |
| InChI | InChI=1S/C28H41F2N3O/c1-16-10-12-27(2)17(14-16)4-5-18-19-6-7-21(28(19,3)13-11-20(18)27)24(34)15-33(32)23-9-8-22(29)25(30)26(23)31/h8-9,16-21H,4-7,10-15,31-32H2,1-3H3/t16?,17?,18?,19?,20?,21?,27?,28-/m0/s1 |
| InChIKey | YCJJYQXKYGWGEK-CSVWPZECSA-N |
| XLogP | 6.09 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|