C28H44N4OS — CID 155395332
2-[amino-(3-amino-2-pyridinyl)amino]-1-[3,13-dimethyl-10-(methylsulfanylmethyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 155395332) has the molecular formula C28H44N4OS and a molecular weight of 484.75 g/mol. Its IUPAC name is 2-[amino-(3-amino-2-pyridinyl)amino]-1-[3,13-dimethyl-10-(methylsulfanylmethyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-[amino-(3-amino-2-pyridinyl)amino]-1-[3,13-dimethyl-10-(methylsulfanylmethyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 155395332 |
| Molecular Formula | C28H44N4OS |
| Molecular Weight | 484.75 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | 2-[amino-(3-amino-2-pyridinyl)amino]-1-[3,13-dimethyl-10-(methylsulfanylmethyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CSCC12CCC(C)CC1CCC1C3CCC(C(=O)CN(N)c4ncccc4N)C3(C)CCC12 |
| InChI | InChI=1S/C28H44N4OS/c1-18-10-13-28(17-34-3)19(15-18)6-7-20-21-8-9-23(27(21,2)12-11-22(20)28)25(33)16-32(30)26-24(29)5-4-14-31-26/h4-5,14,18-23H,6-13,15-17,29-30H2,1-3H3 |
| InChIKey | JDUVYDNGSYGGIO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.75 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|