C26H48N4O — CID 142612909
N'-[amino-[2-(13-ethyl-3,10-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl]amino]ethanimidamide;methane (PubChem CID 142612909) has the molecular formula C26H48N4O and a molecular weight of 432.70 g/mol. Its IUPAC name is N'-[amino-[2-(13-ethyl-3,10-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl]amino]ethanimidamide;methane.
| Compound Name | N'-[amino-[2-(13-ethyl-3,10-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl]amino]ethanimidamide;methane |
|---|---|
| PubChem CID | 142612909 |
| Molecular Formula | C26H48N4O |
| Molecular Weight | 432.70 g/mol |
| Exact Mass | 432.38 |
| IUPAC Name | N'-[amino-[2-(13-ethyl-3,10-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl]amino]ethanimidamide;methane |
| SMILES | C.CCC12CCC3C(CCC4CC(C)CCC43C)C1CCC2C(=O)CN(N)/N=C(/C)N |
| InChI | InChI=1S/C25H44N4O.CH4/c1-5-25-13-11-20-19(7-6-18-14-16(2)10-12-24(18,20)4)21(25)8-9-22(25)23(30)15-29(27)28-17(3)26;/h16,18-22H,5-15,27H2,1-4H3,(H2,26,28);1H4 |
| InChIKey | KOSGRFPSHCNDRM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|