C25H46N4O2 — CID 142612957
N'-[[2-[3a-ethyl-7-(2-methoxyethyl)-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl]-2-oxoethyl]-aminoamino]ethanimidamide (PubChem CID 142612957) has the molecular formula C25H46N4O2 and a molecular weight of 434.67 g/mol. Its IUPAC name is N'-[[2-[3a-ethyl-7-(2-methoxyethyl)-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl]-2-oxoethyl]-aminoamino]ethanimidamide.
| Compound Name | N'-[[2-[3a-ethyl-7-(2-methoxyethyl)-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl]-2-oxoethyl]-aminoamino]ethanimidamide |
|---|---|
| PubChem CID | 142612957 |
| Molecular Formula | C25H46N4O2 |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.36 |
| IUPAC Name | N'-[[2-[3a-ethyl-7-(2-methoxyethyl)-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl]-2-oxoethyl]-aminoamino]ethanimidamide |
| SMILES | CCCC1C(CCOC)CCC2C1CCC1(CC)C(C(=O)CN(N)/N=C(/C)N)CCC21 |
| InChI | InChI=1S/C25H46N4O2/c1-5-7-19-18(13-15-31-4)8-9-21-20(19)12-14-25(6-2)22(21)10-11-23(25)24(30)16-29(27)28-17(3)26/h18-23H,5-16,27H2,1-4H3,(H2,26,28) |
| InChIKey | UHNDWRFAKYYUIQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|