C25H49FN4O2 — CID 144966397
N,N'-diamino-N-[2-[7-(2-fluoroethyl)-3a-methyl-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl]-2-oxoethyl]methanimidamide;ethane;methanol (PubChem CID 144966397) has the molecular formula C25H49FN4O2 and a molecular weight of 456.69 g/mol. Its IUPAC name is N,N'-diamino-N-[2-[7-(2-fluoroethyl)-3a-methyl-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl]-2-oxoethyl]methanimidamide;ethane;methanol.
| Compound Name | N,N'-diamino-N-[2-[7-(2-fluoroethyl)-3a-methyl-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl]-2-oxoethyl]methanimidamide;ethane;methanol |
|---|---|
| PubChem CID | 144966397 |
| Molecular Formula | C25H49FN4O2 |
| Molecular Weight | 456.69 g/mol |
| Exact Mass | 456.38 |
| IUPAC Name | N,N'-diamino-N-[2-[7-(2-fluoroethyl)-3a-methyl-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl]-2-oxoethyl]methanimidamide;ethane;methanol |
| SMILES | CC.CCCC1C(CCF)CCC2C1CCC1(C)C(C(=O)CN(N)/C=N\N)CCC21.CO |
| InChI | InChI=1S/C22H39FN4O.C2H6.CH4O/c1-3-4-16-15(10-12-23)5-6-18-17(16)9-11-22(2)19(18)7-8-20(22)21(28)13-27(25)14-26-24;2*1-2/h14-20H,3-13,24-25H2,1-2H3;1-2H3;2H,1H3/b26-14-;; |
| InChIKey | IGIXVHZEZQPIBV-GAUKCGCWSA-N |
| XLogP | 4.51 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.69 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|