C23H39FN4O — CID 139403492
N,N'-diamino-N-[2-[(3S,5R,8S,10R,13S,17S)-10-fluoro-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]ethanimidamide (PubChem CID 139403492) has the molecular formula C23H39FN4O and a molecular weight of 406.59 g/mol. Its IUPAC name is N,N'-diamino-N-[2-[(3S,5R,8S,10R,13S,17S)-10-fluoro-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]ethanimidamide.
| Compound Name | N,N'-diamino-N-[2-[(3S,5R,8S,10R,13S,17S)-10-fluoro-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]ethanimidamide |
|---|---|
| PubChem CID | 139403492 |
| Molecular Formula | C23H39FN4O |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | N,N'-diamino-N-[2-[(3S,5R,8S,10R,13S,17S)-10-fluoro-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]ethanimidamide |
| SMILES | C/C(=N/N)N(N)CC(=O)[C@H]1CCC2[C@@H]3CC[C@@H]4C[C@@H](C)CC[C@]4(F)C3CC[C@@]21C |
| InChI | InChI=1S/C23H39FN4O/c1-14-8-11-23(24)16(12-14)4-5-17-18-6-7-20(22(18,3)10-9-19(17)23)21(29)13-28(26)15(2)27-25/h14,16-20H,4-13,25-26H2,1-3H3/b27-15-/t14-,16+,17-,18?,19?,20+,22-,23+/m0/s1 |
| InChIKey | MRCFIJKJBJOZSM-ZWZWWSLMSA-N |
| XLogP | 4.02 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|