C27H39F2N3O — CID 155395383
2-(N,2-diamino-5-fluoroanilino)-1-(10-fluoro-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone (PubChem CID 155395383) has the molecular formula C27H39F2N3O and a molecular weight of 459.63 g/mol. Its IUPAC name is 2-(N,2-diamino-5-fluoroanilino)-1-(10-fluoro-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone.
| Compound Name | 2-(N,2-diamino-5-fluoroanilino)-1-(10-fluoro-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone |
|---|---|
| PubChem CID | 155395383 |
| Molecular Formula | C27H39F2N3O |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | 2-(N,2-diamino-5-fluoroanilino)-1-(10-fluoro-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone |
| SMILES | CC1CCC2(F)C(CCC3C4CCC(C(=O)CN(N)c5cc(F)ccc5N)C4(C)CCC32)C1 |
| InChI | InChI=1S/C27H39F2N3O/c1-16-9-12-27(29)17(13-16)3-5-19-20-6-7-22(26(20,2)11-10-21(19)27)25(33)15-32(31)24-14-18(28)4-8-23(24)30/h4,8,14,16-17,19-22H,3,5-7,9-13,15,30-31H2,1-2H3 |
| InChIKey | RHOFTAJZUQYLRN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|