C30H47N3O3 — CID 138661381
2-(N,2-diamino-3-methoxyanilino)-1-[10-(methoxymethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 138661381) has the molecular formula C30H47N3O3 and a molecular weight of 497.72 g/mol. Its IUPAC name is 2-(N,2-diamino-3-methoxyanilino)-1-[10-(methoxymethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-(N,2-diamino-3-methoxyanilino)-1-[10-(methoxymethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 138661381 |
| Molecular Formula | C30H47N3O3 |
| Molecular Weight | 497.72 g/mol |
| Exact Mass | 497.36 |
| IUPAC Name | 2-(N,2-diamino-3-methoxyanilino)-1-[10-(methoxymethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | COCC12CCC(C)CC1CCC1C3CCC(C(=O)CN(N)c4cccc(OC)c4N)C3(C)CCC12 |
| InChI | InChI=1S/C30H47N3O3/c1-19-12-15-30(18-35-3)20(16-19)8-9-21-22-10-11-24(29(22,2)14-13-23(21)30)26(34)17-33(32)25-6-5-7-27(36-4)28(25)31/h5-7,19-24H,8-18,31-32H2,1-4H3 |
| InChIKey | YENIHCURFPKEKH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.72 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|