C28H43ClN4O2 — CID 138662271
2-[amino-(2-amino-5-chloro-3-pyridinyl)amino]-1-[10-(methoxymethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 138662271) has the molecular formula C28H43ClN4O2 and a molecular weight of 503.13 g/mol. Its IUPAC name is 2-[amino-(2-amino-5-chloro-3-pyridinyl)amino]-1-[10-(methoxymethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-[amino-(2-amino-5-chloro-3-pyridinyl)amino]-1-[10-(methoxymethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 138662271 |
| Molecular Formula | C28H43ClN4O2 |
| Molecular Weight | 503.13 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | 2-[amino-(2-amino-5-chloro-3-pyridinyl)amino]-1-[10-(methoxymethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | COCC12CCC(C)CC1CCC1C3CCC(C(=O)CN(N)c4cc(Cl)cnc4N)C3(C)CCC12 |
| InChI | InChI=1S/C28H43ClN4O2/c1-17-8-11-28(16-35-3)18(12-17)4-5-20-21-6-7-23(27(21,2)10-9-22(20)28)25(34)15-33(31)24-13-19(29)14-32-26(24)30/h13-14,17-18,20-23H,4-12,15-16,31H2,1-3H3,(H2,30,32) |
| InChIKey | PMBHGSRCDSRWPG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.13 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|