C25H42N4O2 — CID 166762932
(Z)-2-amino-3-[amino-[2-oxo-2-[(17S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]amino]prop-2-enamide (PubChem CID 166762932) has the molecular formula C25H42N4O2 and a molecular weight of 430.64 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[2-oxo-2-[(17S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]amino]prop-2-enamide.
| Compound Name | (Z)-2-amino-3-[amino-[2-oxo-2-[(17S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]amino]prop-2-enamide |
|---|---|
| PubChem CID | 166762932 |
| Molecular Formula | C25H42N4O2 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | (Z)-2-amino-3-[amino-[2-oxo-2-[(17S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]amino]prop-2-enamide |
| SMILES | CC1CCC2(C)C(CCC3C2CCC2(C)C3CC[C@@H]2C(=O)CN(N)/C=C(\N)C(N)=O)C1 |
| InChI | InChI=1S/C25H42N4O2/c1-15-8-10-24(2)16(12-15)4-5-17-18-6-7-20(25(18,3)11-9-19(17)24)22(30)14-29(28)13-21(26)23(27)31/h13,15-20H,4-12,14,26,28H2,1-3H3,(H2,27,31)/b21-13-/t15?,16?,17?,18?,19?,20-,24?,25?/m1/s1 |
| InChIKey | UBFBVYFSASYXOY-BIRBTDKNSA-N |
| XLogP | 3.31 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|