C28H48N6O — CID 145065273
2-[[(Z)-ethylideneamino]-(methylideneamino)amino]-1-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone;methane;2H-triazole (PubChem CID 145065273) has the molecular formula C28H48N6O and a molecular weight of 484.73 g/mol. Its IUPAC name is 2-[[(Z)-ethylideneamino]-(methylideneamino)amino]-1-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone;methane;2H-triazole.
| Compound Name | 2-[[(Z)-ethylideneamino]-(methylideneamino)amino]-1-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone;methane;2H-triazole |
|---|---|
| PubChem CID | 145065273 |
| Molecular Formula | C28H48N6O |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.39 |
| IUPAC Name | 2-[[(Z)-ethylideneamino]-(methylideneamino)amino]-1-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone;methane;2H-triazole |
| SMILES | C.C=NN(CC(=O)C1CCC2C3CCC4CC(C)CCC4(C)C3CCC12C)/N=C\C.c1cn[nH]n1 |
| InChI | InChI=1S/C25H41N3O.C2H3N3.CH4/c1-6-27-28(26-5)16-23(29)22-10-9-20-19-8-7-18-15-17(2)11-13-24(18,3)21(19)12-14-25(20,22)4;1-2-4-5-3-1;/h6,17-22H,5,7-16H2,1-4H3;1-2H,(H,3,4,5);1H4/b27-6-;; |
| InChIKey | RXJPOBYYKMLENS-AUJVRCJVSA-N |
| XLogP | 6.21 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|