C25H43N3O — CID 142612952
2-[amino-[(Z)-2-aminoethenyl]amino]-1-(10-ethyl-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone (PubChem CID 142612952) has the molecular formula C25H43N3O and a molecular weight of 401.64 g/mol. Its IUPAC name is 2-[amino-[(Z)-2-aminoethenyl]amino]-1-(10-ethyl-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone.
| Compound Name | 2-[amino-[(Z)-2-aminoethenyl]amino]-1-(10-ethyl-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone |
|---|---|
| PubChem CID | 142612952 |
| Molecular Formula | C25H43N3O |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.34 |
| IUPAC Name | 2-[amino-[(Z)-2-aminoethenyl]amino]-1-(10-ethyl-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone |
| SMILES | CCC12CCC(C)CC1CCC1C3CCC(C(=O)CN(N)/C=C\N)C3(C)CCC12 |
| InChI | InChI=1S/C25H43N3O/c1-4-25-12-9-17(2)15-18(25)5-6-19-20-7-8-22(23(29)16-28(27)14-13-26)24(20,3)11-10-21(19)25/h13-14,17-22H,4-12,15-16,26-27H2,1-3H3/b14-13- |
| InChIKey | JNISKQGKFZNVRT-YPKPFQOOSA-N |
| XLogP | 4.85 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|