C25H44N4O2 — CID 155236525
N,N'-diamino-N-[2-[(3S,5S,8S,9S,10R,13S,17S)-10-(methoxymethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]ethanimidamide (PubChem CID 155236525) has the molecular formula C25H44N4O2 and a molecular weight of 432.65 g/mol. Its IUPAC name is N,N'-diamino-N-[2-[(3S,5S,8S,9S,10R,13S,17S)-10-(methoxymethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]ethanimidamide.
| Compound Name | N,N'-diamino-N-[2-[(3S,5S,8S,9S,10R,13S,17S)-10-(methoxymethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]ethanimidamide |
|---|---|
| PubChem CID | 155236525 |
| Molecular Formula | C25H44N4O2 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | N,N'-diamino-N-[2-[(3S,5S,8S,9S,10R,13S,17S)-10-(methoxymethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]ethanimidamide |
| SMILES | COC[C@]12CC[C@H](C)C[C@@H]1CC[C@H]1C3CC[C@H](C(=O)CN(N)/C(C)=N\N)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C25H44N4O2/c1-16-9-12-25(15-31-4)18(13-16)5-6-19-20-7-8-22(24(20,3)11-10-21(19)25)23(30)14-29(27)17(2)28-26/h16,18-22H,5-15,26-27H2,1-4H3/b28-17-/t16-,18-,19-,20?,21-,22+,24-,25+/m0/s1 |
| InChIKey | FEJLRZCPEJQKRV-QMKVQUIYSA-N |
| XLogP | 3.94 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|