C25H44N4O3 — CID 155236514
N'-[amino-[2-[3-hydroxy-10-(methoxymethyl)-3,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl]amino]ethanimidamide (PubChem CID 155236514) has the molecular formula C25H44N4O3 and a molecular weight of 448.65 g/mol. Its IUPAC name is N'-[amino-[2-[3-hydroxy-10-(methoxymethyl)-3,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl]amino]ethanimidamide.
| Compound Name | N'-[amino-[2-[3-hydroxy-10-(methoxymethyl)-3,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl]amino]ethanimidamide |
|---|---|
| PubChem CID | 155236514 |
| Molecular Formula | C25H44N4O3 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.34 |
| IUPAC Name | N'-[amino-[2-[3-hydroxy-10-(methoxymethyl)-3,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl]amino]ethanimidamide |
| SMILES | COCC12CCC(C)(O)CC1CCC1C3CCC(C(=O)CN(N)/N=C(/C)N)C3(C)CCC12 |
| InChI | InChI=1S/C25H44N4O3/c1-16(26)28-29(27)14-22(30)21-8-7-19-18-6-5-17-13-23(2,31)11-12-25(17,15-32-4)20(18)9-10-24(19,21)3/h17-21,31H,5-15,27H2,1-4H3,(H2,26,28) |
| InChIKey | AIOMVESIYHREPP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|