C26H46N4O2 — CID 144966371
(Z)-2-amino-3-[amino-[2-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl]amino]prop-2-enamide;ethane (PubChem CID 144966371) has the molecular formula C26H46N4O2 and a molecular weight of 446.68 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[2-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl]amino]prop-2-enamide;ethane.
| Compound Name | (Z)-2-amino-3-[amino-[2-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl]amino]prop-2-enamide;ethane |
|---|---|
| PubChem CID | 144966371 |
| Molecular Formula | C26H46N4O2 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.36 |
| IUPAC Name | (Z)-2-amino-3-[amino-[2-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl]amino]prop-2-enamide;ethane |
| SMILES | CC.CC1CCC2C(CCC3C2CCC2(C)C(C(=O)CN(N)/C=C(\N)C(N)=O)CCC32)C1 |
| InChI | InChI=1S/C24H40N4O2.C2H6/c1-14-3-5-16-15(11-14)4-6-18-17(16)9-10-24(2)19(18)7-8-20(24)22(29)13-28(27)12-21(25)23(26)30;1-2/h12,14-20H,3-11,13,25,27H2,1-2H3,(H2,26,30);1-2H3/b21-12-; |
| InChIKey | LZHPZNDCHXWLHA-SDKPGJOKSA-N |
| XLogP | 3.95 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|