C28H49N3O2 — CID 144732762
4-[2-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl]piperazine-1-carbaldehyde;N-methylmethanamine (PubChem CID 144732762) has the molecular formula C28H49N3O2 and a molecular weight of 459.72 g/mol. Its IUPAC name is 4-[2-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl]piperazine-1-carbaldehyde;N-methylmethanamine.
| Compound Name | 4-[2-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl]piperazine-1-carbaldehyde;N-methylmethanamine |
|---|---|
| PubChem CID | 144732762 |
| Molecular Formula | C28H49N3O2 |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 459.38 |
| IUPAC Name | 4-[2-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl]piperazine-1-carbaldehyde;N-methylmethanamine |
| SMILES | CC1CCC2C(CCC3C2CCC2(C)C(C(=O)CN4CCN(C=O)CC4)CCC32)C1.CNC |
| InChI | InChI=1S/C26H42N2O2.C2H7N/c1-18-3-5-20-19(15-18)4-6-22-21(20)9-10-26(2)23(22)7-8-24(26)25(30)16-27-11-13-28(17-29)14-12-27;1-3-2/h17-24H,3-16H2,1-2H3;3H,1-2H3 |
| InChIKey | WZTGZGBJALOBNW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|