C22H38N2O — CID 155007150
2-[amino(methyl)amino]-1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)ethanone (PubChem CID 155007150) has the molecular formula C22H38N2O and a molecular weight of 346.56 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)ethanone.
| Compound Name | 2-[amino(methyl)amino]-1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)ethanone |
|---|---|
| PubChem CID | 155007150 |
| Molecular Formula | C22H38N2O |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.30 |
| IUPAC Name | 2-[amino(methyl)amino]-1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)ethanone |
| SMILES | CC1CCC2C(CCC3C2CCC2(C)C(C(=O)CN(C)N)CCC32)C1 |
| InChI | InChI=1S/C22H38N2O/c1-14-4-6-16-15(12-14)5-7-18-17(16)10-11-22(2)19(18)8-9-20(22)21(25)13-24(3)23/h14-20H,4-13,23H2,1-3H3 |
| InChIKey | KMIDJEAEGXYFKU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|