C28H37ClN2O — CID 144732519
2-(3-chloroindazol-1-yl)-1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)ethanone (PubChem CID 144732519) has the molecular formula C28H37ClN2O and a molecular weight of 453.07 g/mol. Its IUPAC name is 2-(3-chloroindazol-1-yl)-1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)ethanone.
| Compound Name | 2-(3-chloroindazol-1-yl)-1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)ethanone |
|---|---|
| PubChem CID | 144732519 |
| Molecular Formula | C28H37ClN2O |
| Molecular Weight | 453.07 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 2-(3-chloroindazol-1-yl)-1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)ethanone |
| SMILES | CC1CCC2C(CCC3C2CCC2(C)C(C(=O)Cn4nc(Cl)c5ccccc54)CCC32)C1 |
| InChI | InChI=1S/C28H37ClN2O/c1-17-7-9-19-18(15-17)8-10-21-20(19)13-14-28(2)23(21)11-12-24(28)26(32)16-31-25-6-4-3-5-22(25)27(29)30-31/h3-6,17-21,23-24H,7-16H2,1-2H3 |
| InChIKey | MUAVKLVTRDOIIL-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.07 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |