C28H37FN2O — CID 144732452
1-[(3S,5R,8R,10S,13S,17S)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]-2-(6-fluoroindazol-2-yl)ethanone (PubChem CID 144732452) has the molecular formula C28H37FN2O and a molecular weight of 436.62 g/mol. Its IUPAC name is 1-[(3S,5R,8R,10S,13S,17S)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]-2-(6-fluoroindazol-2-yl)ethanone.
| Compound Name | 1-[(3S,5R,8R,10S,13S,17S)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]-2-(6-fluoroindazol-2-yl)ethanone |
|---|---|
| PubChem CID | 144732452 |
| Molecular Formula | C28H37FN2O |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | 1-[(3S,5R,8R,10S,13S,17S)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]-2-(6-fluoroindazol-2-yl)ethanone |
| SMILES | C[C@H]1CC[C@@H]2C3CC[C@@]4(C)C(CC[C@@H]4C(=O)Cn4cc5ccc(F)cc5n4)[C@@H]3CC[C@@H]2C1 |
| InChI | InChI=1S/C28H37FN2O/c1-17-3-7-21-18(13-17)5-8-23-22(21)11-12-28(2)24(23)9-10-25(28)27(32)16-31-15-19-4-6-20(29)14-26(19)30-31/h4,6,14-15,17-18,21-25H,3,5,7-13,16H2,1-2H3/t17-,18+,21-,22?,23+,24?,25+,28-/m0/s1 |
| InChIKey | LHFJTVOZQWRNLP-ZXQFGZHYSA-N |
| XLogP | 6.65 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |