C28H40F2O — CID 145087733
(3,5-difluorophenyl)-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)methanone;ethane (PubChem CID 145087733) has the molecular formula C28H40F2O and a molecular weight of 430.62 g/mol. Its IUPAC name is (3,5-difluorophenyl)-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)methanone;ethane.
| Compound Name | (3,5-difluorophenyl)-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)methanone;ethane |
|---|---|
| PubChem CID | 145087733 |
| Molecular Formula | C28H40F2O |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.30 |
| IUPAC Name | (3,5-difluorophenyl)-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)methanone;ethane |
| SMILES | CC.CC1CCC2C(CCC3C2CCC2(C)C(C(=O)c4cc(F)cc(F)c4)CCC32)C1 |
| InChI | InChI=1S/C26H34F2O.C2H6/c1-15-3-5-20-16(11-15)4-6-22-21(20)9-10-26(2)23(22)7-8-24(26)25(29)17-12-18(27)14-19(28)13-17;1-2/h12-16,20-24H,3-11H2,1-2H3;1-2H3 |
| InChIKey | VEFPGHSURPJQIR-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |