C27H36O3 — CID 145087732
1,3-benzodioxol-5-yl-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)methanone (PubChem CID 145087732) has the molecular formula C27H36O3 and a molecular weight of 408.58 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)methanone.
| Compound Name | 1,3-benzodioxol-5-yl-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)methanone |
|---|---|
| PubChem CID | 145087732 |
| Molecular Formula | C27H36O3 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | 1,3-benzodioxol-5-yl-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)methanone |
| SMILES | CC1CCC2C(CCC3C2CCC2(C)C(C(=O)c4ccc5c(c4)OCO5)CCC32)C1 |
| InChI | InChI=1S/C27H36O3/c1-16-3-6-19-17(13-16)4-7-21-20(19)11-12-27(2)22(21)8-9-23(27)26(28)18-5-10-24-25(14-18)30-15-29-24/h5,10,14,16-17,19-23H,3-4,6-9,11-13,15H2,1-2H3 |
| InChIKey | ZHABVQWBZCMNEH-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |