C25H41NO2 — CID 170198665
(8R)-3,13-dimethyl-N-(oxan-4-yl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 170198665) has the molecular formula C25H41NO2 and a molecular weight of 387.61 g/mol. Its IUPAC name is (8R)-3,13-dimethyl-N-(oxan-4-yl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (8R)-3,13-dimethyl-N-(oxan-4-yl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 170198665 |
| Molecular Formula | C25H41NO2 |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.31 |
| IUPAC Name | (8R)-3,13-dimethyl-N-(oxan-4-yl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CC1CCC2C(CC[C@@H]3C2CCC2(C)C(C(=O)NC4CCOCC4)CCC32)C1 |
| InChI | InChI=1S/C25H41NO2/c1-16-3-5-19-17(15-16)4-6-21-20(19)9-12-25(2)22(21)7-8-23(25)24(27)26-18-10-13-28-14-11-18/h16-23H,3-15H2,1-2H3,(H,26,27)/t16?,17?,19?,20?,21-,22?,23?,25?/m1/s1 |
| InChIKey | YKFZUGJMZSTABI-CGPJSAFDSA-N |
| XLogP | 5.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |