C26H38N2O — CID 134175072
3,13-dimethyl-N-(pyridin-2-ylmethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 134175072) has the molecular formula C26H38N2O and a molecular weight of 394.60 g/mol. Its IUPAC name is 3,13-dimethyl-N-(pyridin-2-ylmethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | 3,13-dimethyl-N-(pyridin-2-ylmethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 134175072 |
| Molecular Formula | C26H38N2O |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.30 |
| IUPAC Name | 3,13-dimethyl-N-(pyridin-2-ylmethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CC1CCC2C(CCC3C2CCC2(C)C(C(=O)NCc4ccccn4)CCC32)C1 |
| InChI | InChI=1S/C26H38N2O/c1-17-6-8-20-18(15-17)7-9-22-21(20)12-13-26(2)23(22)10-11-24(26)25(29)28-16-19-5-3-4-14-27-19/h3-5,14,17-18,20-24H,6-13,15-16H2,1-2H3,(H,28,29) |
| InChIKey | WREBNBCGEFCGJY-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |