C28H42NOP — CID 170121894
N-[[(1S,4aS,4bR,6aR,8S,10aS,10bR,12aS)-8,12a-dimethyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydro-1H-chrysen-1-yl]methyl]-2-phosphanylbenzamide (PubChem CID 170121894) has the molecular formula C28H42NOP and a molecular weight of 439.62 g/mol. Its IUPAC name is N-[[(1S,4aS,4bR,6aR,8S,10aS,10bR,12aS)-8,12a-dimethyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydro-1H-chrysen-1-yl]methyl]-2-phosphanylbenzamide.
| Compound Name | N-[[(1S,4aS,4bR,6aR,8S,10aS,10bR,12aS)-8,12a-dimethyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydro-1H-chrysen-1-yl]methyl]-2-phosphanylbenzamide |
|---|---|
| PubChem CID | 170121894 |
| Molecular Formula | C28H42NOP |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.30 |
| IUPAC Name | N-[[(1S,4aS,4bR,6aR,8S,10aS,10bR,12aS)-8,12a-dimethyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydro-1H-chrysen-1-yl]methyl]-2-phosphanylbenzamide |
| SMILES | C[C@H]1CC[C@H]2[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](CNC(=O)c4ccccc4P)CCC[C@@H]32)C1 |
| InChI | InChI=1S/C28H42NOP/c1-18-10-12-21-19(16-18)11-13-23-22(21)14-15-28(2)20(6-5-8-25(23)28)17-29-27(30)24-7-3-4-9-26(24)31/h3-4,7,9,18-23,25H,5-6,8,10-17,31H2,1-2H3,(H,29,30)/t18-,19+,20+,21-,22+,23+,25-,28+/m0/s1 |
| InChIKey | ZNJZXLBWPFAKQO-XCKMAGRASA-N |
| XLogP | 6.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|