C29H43NO2 — CID 174138031
N-[[(3S,8R,10S,13S,17S)-3-(ethoxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]methyl]benzamide (PubChem CID 174138031) has the molecular formula C29H43NO2 and a molecular weight of 437.67 g/mol. Its IUPAC name is N-[[(3S,8R,10S,13S,17S)-3-(ethoxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]methyl]benzamide.
| Compound Name | N-[[(3S,8R,10S,13S,17S)-3-(ethoxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]methyl]benzamide |
|---|---|
| PubChem CID | 174138031 |
| Molecular Formula | C29H43NO2 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.33 |
| IUPAC Name | N-[[(3S,8R,10S,13S,17S)-3-(ethoxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]methyl]benzamide |
| SMILES | CCOC[C@H]1CC[C@H]2C(CC[C@@H]3C2CC[C@@]2(C)C3CC[C@@H]2CNC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C29H43NO2/c1-3-32-19-20-9-12-24-22(17-20)10-13-26-25(24)15-16-29(2)23(11-14-27(26)29)18-30-28(31)21-7-5-4-6-8-21/h4-8,20,22-27H,3,9-19H2,1-2H3,(H,30,31)/t20-,22?,23+,24-,25?,26+,27?,29+/m0/s1 |
| InChIKey | GFGCDEPXRPLBEP-KVGRNMDVSA-N |
| XLogP | 6.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |