C27H39NO — CID 146659799
N-[[(13S,17S)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]methyl]benzamide (PubChem CID 146659799) has the molecular formula C27H39NO and a molecular weight of 393.62 g/mol. Its IUPAC name is N-[[(13S,17S)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]methyl]benzamide.
| Compound Name | N-[[(13S,17S)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]methyl]benzamide |
|---|---|
| PubChem CID | 146659799 |
| Molecular Formula | C27H39NO |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 393.30 |
| IUPAC Name | N-[[(13S,17S)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]methyl]benzamide |
| SMILES | CC1CCC2C(CCC3C2CC[C@@]2(C)C3CC[C@@H]2CNC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C27H39NO/c1-18-8-11-22-20(16-18)9-12-24-23(22)14-15-27(2)21(10-13-25(24)27)17-28-26(29)19-6-4-3-5-7-19/h3-7,18,20-25H,8-17H2,1-2H3,(H,28,29)/t18?,20?,21-,22?,23?,24?,25?,27-/m1/s1 |
| InChIKey | NCHSLBXJIPUFGJ-WUFUGNMISA-N |
| XLogP | 6.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |