C31H45F2NO2 — CID 163910761
N-[(1R)-1-[(1S,4bR,6aR,8S,10aS,12aS)-8-(ethoxymethyl)-12a-methyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydro-1H-chrysen-1-yl]ethyl]-2,4-difluorobenzamide (PubChem CID 163910761) has the molecular formula C31H45F2NO2 and a molecular weight of 501.70 g/mol. Its IUPAC name is N-[(1R)-1-[(1S,4bR,6aR,8S,10aS,12aS)-8-(ethoxymethyl)-12a-methyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydro-1H-chrysen-1-yl]ethyl]-2,4-difluorobenzamide.
| Compound Name | N-[(1R)-1-[(1S,4bR,6aR,8S,10aS,12aS)-8-(ethoxymethyl)-12a-methyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydro-1H-chrysen-1-yl]ethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 163910761 |
| Molecular Formula | C31H45F2NO2 |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.34 |
| IUPAC Name | N-[(1R)-1-[(1S,4bR,6aR,8S,10aS,12aS)-8-(ethoxymethyl)-12a-methyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydro-1H-chrysen-1-yl]ethyl]-2,4-difluorobenzamide |
| SMILES | CCOC[C@H]1CC[C@@H]2C3CC[C@@]4(C)C(CCC[C@@H]4[C@@H](C)NC(=O)c4ccc(F)cc4F)[C@@H]3CC[C@@H]2C1 |
| InChI | InChI=1S/C31H45F2NO2/c1-4-36-18-20-8-11-23-21(16-20)9-12-25-24(23)14-15-31(3)27(6-5-7-28(25)31)19(2)34-30(35)26-13-10-22(32)17-29(26)33/h10,13,17,19-21,23-25,27-28H,4-9,11-12,14-16,18H2,1-3H3,(H,34,35)/t19-,20+,21-,23+,24?,25-,27-,28?,31-/m1/s1 |
| InChIKey | QRWPKPRZDOVQQQ-DQYYDQBSSA-N |
| XLogP | 7.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |