C28H38FN3O — CID 145065306
2-(5-fluoropyrazolo[3,4-c]pyridin-2-yl)-1-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone (PubChem CID 145065306) has the molecular formula C28H38FN3O and a molecular weight of 451.63 g/mol. Its IUPAC name is 2-(5-fluoropyrazolo[3,4-c]pyridin-2-yl)-1-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone.
| Compound Name | 2-(5-fluoropyrazolo[3,4-c]pyridin-2-yl)-1-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone |
|---|---|
| PubChem CID | 145065306 |
| Molecular Formula | C28H38FN3O |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.30 |
| IUPAC Name | 2-(5-fluoropyrazolo[3,4-c]pyridin-2-yl)-1-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone |
| SMILES | CC1CCC2(C)C(CCC3C2CCC2(C)C(C(=O)Cn4cc5cc(F)ncc5n4)CCC32)C1 |
| InChI | InChI=1S/C28H38FN3O/c1-17-8-10-27(2)19(12-17)4-5-20-21-6-7-23(28(21,3)11-9-22(20)27)25(33)16-32-15-18-13-26(29)30-14-24(18)31-32/h13-15,17,19-23H,4-12,16H2,1-3H3 |
| InChIKey | FYOTXOYDQQKZPY-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|