C25H45Br — CID 146659406
(3R,3aS,5aR,6S,7S,9aR,9bS)-3-(1-bromopropan-2-yl)-3a-methyl-7-(3-methylbutyl)-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalene (PubChem CID 146659406) has the molecular formula C25H45Br and a molecular weight of 425.54 g/mol. Its IUPAC name is (3R,3aS,5aR,6S,7S,9aR,9bS)-3-(1-bromopropan-2-yl)-3a-methyl-7-(3-methylbutyl)-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalene.
| Compound Name | (3R,3aS,5aR,6S,7S,9aR,9bS)-3-(1-bromopropan-2-yl)-3a-methyl-7-(3-methylbutyl)-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 146659406 |
| Molecular Formula | C25H45Br |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | (3R,3aS,5aR,6S,7S,9aR,9bS)-3-(1-bromopropan-2-yl)-3a-methyl-7-(3-methylbutyl)-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalene |
| SMILES | CCC[C@H]1[C@@H](CCC(C)C)CC[C@@H]2[C@@H]1CC[C@]1(C)[C@@H](C(C)CBr)CC[C@@H]21 |
| InChI | InChI=1S/C25H45Br/c1-6-7-20-19(9-8-17(2)3)10-11-22-21(20)14-15-25(5)23(18(4)16-26)12-13-24(22)25/h17-24H,6-16H2,1-5H3/t18?,19-,20-,21+,22+,23+,24-,25+/m0/s1 |
| InChIKey | UJZGGRKDFHYJEN-RXYCRVMGSA-N |
| XLogP | 8.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|