C24H41BrO — CID 146660049
(3R,5R,8R,9S,10S,13S,14S,17R)-17-(1-bromopropan-2-yl)-3-ethyl-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 146660049) has the molecular formula C24H41BrO and a molecular weight of 425.50 g/mol. Its IUPAC name is (3R,5R,8R,9S,10S,13S,14S,17R)-17-(1-bromopropan-2-yl)-3-ethyl-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5R,8R,9S,10S,13S,14S,17R)-17-(1-bromopropan-2-yl)-3-ethyl-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 146660049 |
| Molecular Formula | C24H41BrO |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | (3R,5R,8R,9S,10S,13S,14S,17R)-17-(1-bromopropan-2-yl)-3-ethyl-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@@]1(O)CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](C(C)CBr)CC[C@@H]32)C1 |
| InChI | InChI=1S/C24H41BrO/c1-5-24(26)13-12-22(3)17(14-24)6-7-18-20-9-8-19(16(2)15-25)23(20,4)11-10-21(18)22/h16-21,26H,5-15H2,1-4H3/t16?,17-,18+,19-,20+,21+,22+,23-,24-/m1/s1 |
| InChIKey | MPTHTFFNNJDXHL-YHKLVSPNSA-N |
| XLogP | 6.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|