C25H43IO — CID 167490533
(3S,5S,8R,9S,10S,13R,14S,15S,17R)-3-ethyl-17-[(2S)-1-iodopropan-2-yl]-10,13,15-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 167490533) has the molecular formula C25H43IO and a molecular weight of 486.52 g/mol. Its IUPAC name is (3S,5S,8R,9S,10S,13R,14S,15S,17R)-3-ethyl-17-[(2S)-1-iodopropan-2-yl]-10,13,15-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5S,8R,9S,10S,13R,14S,15S,17R)-3-ethyl-17-[(2S)-1-iodopropan-2-yl]-10,13,15-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 167490533 |
| Molecular Formula | C25H43IO |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | (3S,5S,8R,9S,10S,13R,14S,15S,17R)-3-ethyl-17-[(2S)-1-iodopropan-2-yl]-10,13,15-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@]1(O)CC[C@@]2(C)[C@@H](CC[C@H]3[C@@H]4[C@@H](C)C[C@H]([C@H](C)CI)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C25H43IO/c1-6-25(27)12-11-23(4)18(14-25)7-8-19-20(23)9-10-24(5)21(17(3)15-26)13-16(2)22(19)24/h16-22,27H,6-15H2,1-5H3/t16-,17+,18-,19+,20-,21+,22-,23-,24+,25-/m0/s1 |
| InChIKey | SNQLPHRCBFVMFD-VGHMKUFBSA-N |
| XLogP | 7.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|