C27H45IO — CID 167490251
(3S,5S,8R,9S,10S,13R,14S,15R,17R)-15-cyclopropyl-3-ethyl-17-[(2S)-1-iodopropan-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 167490251) has the molecular formula C27H45IO and a molecular weight of 512.56 g/mol. Its IUPAC name is (3S,5S,8R,9S,10S,13R,14S,15R,17R)-15-cyclopropyl-3-ethyl-17-[(2S)-1-iodopropan-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5S,8R,9S,10S,13R,14S,15R,17R)-15-cyclopropyl-3-ethyl-17-[(2S)-1-iodopropan-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 167490251 |
| Molecular Formula | C27H45IO |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | (3S,5S,8R,9S,10S,13R,14S,15R,17R)-15-cyclopropyl-3-ethyl-17-[(2S)-1-iodopropan-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@]1(O)CC[C@@]2(C)[C@@H](CC[C@H]3[C@@H]4[C@@H](C5CC5)C[C@H]([C@H](C)CI)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C27H45IO/c1-5-27(29)13-12-25(3)19(15-27)8-9-20-22(25)10-11-26(4)23(17(2)16-28)14-21(24(20)26)18-6-7-18/h17-24,29H,5-16H2,1-4H3/t17-,19+,20-,21-,22+,23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | BWOFGZIGHTYCIB-WKMBEXHPSA-N |
| XLogP | 7.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|